| MolName | (Z)-N-[4-(4-chlorophenyl)piperazin-1-yl]-1-(2,6-dichlorophenyl)methanimine |
| MolecularFormula | C17H16N3Cl3 |
| Smiles | Clc(cc1)ccc1N(CC1)CCN1N=Cc(c(Cl)ccc1)c1Cl |
| InChI | InChI=1S/C17H16Cl3N3/c18-13-4-6-14(7-5-13)22-8-10-23(11-9-22)21-12-15-16(19)2-1-3-17(15)20/h1-7,12H,8-11H2 |
| InChIK | SWTOZMFPYMFHJG-UHFFFAOYSA-N |
| TotalMolweight | 368.694 |
| Molweight | 368.694 |
| MonoisotopicMass | 367.040978 |
| CLogP | 4.9141 |
| CLogS | -5.386 |
| H Acceptors | 3 |
| TotalSurfaceArea | 266.18 |
| Relative PSA | 0.069915 |
| PolarSurfaceArea | 18.84 |
| Druglikeness | 6.6683 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.65217 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 5 |
| Symmetricatoms | 7 |
| Amines | 1 |
| Aromatic Amines | 1 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-N-[4-(4-chlorophenyl)piperazin-1-yl]-1-(2,6-dichlorophenyl)methanimine | 2 - (Z)-N-[4-(4-chlorophenyl)piperazin-1-yl]-1-(2,6-dichlorophenyl)methanimine