| MolName | 2-(3-nitrophenoxy)-N-[(Z)-thiophen-2-ylmethylideneamino]acetamide |
| MolecularFormula | C13H11N3O4S |
| Smiles | [O-][N+](c1cccc(OCC(N/N=C\c2cccs2)=O)c1)=O |
| InChI | InChI=1S/C13H11N3O4S/c17-13(15-14-8-12-5-2-6-21-12)9-20-11-4-1-3-10(7-11)16(18)19/h1-8H,9H2,(H,15,17) |
| InChIK | SWXJEAZVBLODEM-UHFFFAOYSA-N |
| TotalMolweight | 305.313 |
| Molweight | 305.313 |
| MonoisotopicMass | 305.047027 |
| CLogP | 1.7215 |
| CLogS | -3.971 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 230.36 |
| Relative PSA | 0.42017 |
| PolarSurfaceArea | 124.75 |
| Druglikeness | 0.78988 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-(3-nitrophenoxy)-N-[(Z)-thiophen-2-ylmethylideneamino]acetamide | 2 - 2-(3-nitrophenoxy)-N-[(Z)-thiophen-2-ylmethylideneamino]acetamide