| MolName | 2-nitro-N-[(Z)-(5-nitrofuran-2-yl)methylideneamino]benzamide |
| MolecularFormula | C12H8N4O6 |
| Smiles | [O-][N+](c1ccc(/C=N\NC(c(cccc2)c2[N+]([O-])=O)=O)o1)=O |
| InChI | InChI=1S/C12H8N4O6/c17-12(9-3-1-2-4-10(9)15(18)19)14-13-7-8-5-6-11(22-8)16(20)21/h1-7H,(H,14,17) |
| InChIK | SXHNPBNXANBSAZ-UHFFFAOYSA-N |
| TotalMolweight | 304.218 |
| Molweight | 304.218 |
| MonoisotopicMass | 304.044386 |
| CLogP | 0.8985 |
| CLogS | -4.848 |
| H Acceptors | 10 |
| H Donors | 1 |
| TotalSurfaceArea | 224.02 |
| Relative PSA | 0.49531 |
| PolarSurfaceArea | 146.24 |
| Druglikeness | 3.0702 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.59091 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 2 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-nitro-N-[(Z)-(5-nitrofuran-2-yl)methylideneamino]benzamide | 2 - 2-nitro-N-[(Z)-(5-nitrofuran-2-yl)methylideneamino]benzamide