| MolName | 3-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-1,3-diazaspiro[4.5]decane-2,4-dione |
| MolecularFormula | C16H17N3O4 |
| Smiles | O=C(C1(CCCCC1)NC1=O)N1/N=C\c(cc1)cc2c1OCO2 |
| InChI | InChI=1S/C16H17N3O4/c20-14-16(6-2-1-3-7-16)18-15(21)19(14)17-9-11-4-5-12-13(8-11)23-10-22-12/h4-5,8-9H,1-3,6-7,10H2,(H,18,21) |
| InChIK | SXNHOYWTZHMSNA-UHFFFAOYSA-N |
| TotalMolweight | 315.328 |
| Molweight | 315.328 |
| MonoisotopicMass | 315.121907 |
| CLogP | 2.2622 |
| CLogS | -4.447 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 227.75 |
| Relative PSA | 0.31877 |
| PolarSurfaceArea | 80.23 |
| Druglikeness | 1.4665 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.56522 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 2 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 9 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-1,3-diazaspiro[4.5]decane-2,4-dione | 2 - 3-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-1,3-diazaspiro[4.5]decane-2,4-dione