| MolName | 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(E)-[(E)-3-(3-nitrophenyl)prop-2-enylidene]amino]acetamide |
| MolecularFormula | C13H12N6O3S |
| Smiles | Nc1nnc(CC(N/N=C/C=C/c2cc([N+]([O-])=O)ccc2)=O)s1 |
| InChI | InChI=1S/C13H12N6O3S/c14-13-18-17-12(23-13)8-11(20)16-15-6-2-4-9-3-1-5-10(7-9)19(21)22/h1-7H,8H2,(H2,14,18)(H,16,20) |
| InChIK | SYBFWZUGYFCJFN-UHFFFAOYSA-N |
| TotalMolweight | 332.343 |
| Molweight | 332.343 |
| MonoisotopicMass | 332.069159 |
| CLogP | 0.4621 |
| CLogS | -3.721 |
| H Acceptors | 9 |
| H Donors | 2 |
| TotalSurfaceArea | 252.9 |
| Relative PSA | 0.49031 |
| PolarSurfaceArea | 167.32 |
| Druglikeness | 0.76042 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.69565 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 2 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(E)-[(E)-3-(3-nitrophenyl)prop-2-enylidene]amino]acetamide | 2 - 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(E)-[(E)-3-(3-nitrophenyl)prop-2-enylidene]amino]acetamide