| MolName | 4-[(Z)-[[2-(2-bromo-4-chlorophenoxy)acetyl]hydrazinylidene]methyl]benzoate |
| MolecularFormula | C16H11N2O4BrCl |
| Smiles | [O-]C(c1ccc(/C=N\NC(COc(ccc(Cl)c2)c2Br)=O)cc1)=O |
| InChI | InChI=1S/C16H12BrClN2O4/c17-13-7-12(18)5-6-14(13)24-9-15(21)20-19-8-10-1-3-11(4-2-10)16(22)23/h1-8H,9H2,(H,20,21)(H,22,23)/p-1 |
| InChIK | SYIFBHZJHBQOHS-UHFFFAOYSA-M |
| TotalMolweight | 410.63 |
| Molweight | 410.63 |
| MonoisotopicMass | 408.959071 |
| CLogP | 1.5168 |
| CLogS | -5.084 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 270.08 |
| Relative PSA | 0.27151 |
| PolarSurfaceArea | 90.82 |
| Druglikeness | 2.4962 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.70833 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-[[2-(2-bromo-4-chlorophenoxy)acetyl]hydrazinylidene]methyl]benzoate | 2 - 4-[(Z)-[[2-(2-bromo-4-chlorophenoxy)acetyl]hydrazinylidene]methyl]benzoate