| MolName | (3Z)-3-[(Z)-[2-cyano-2-(triphenyl-lambda5-phosphanylidene)ethylidene]hydrazinylidene]-2-(triphenyl-lambda5-phosphanylidene)propanenitrile |
| MolecularFormula | C42H32N4P2 |
| Smiles | N#CC(/C=N\N=C/C(C#N)=P(c1ccccc1)(c1ccccc1)c1ccccc1)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C42H32N4P2/c43-31-41(47(35-19-7-1-8-20-35,36-21-9-2-10-22-36)37-23-11-3-12-24-37)33-45-46-34-42(32-44)48(38-25-13-4-14-26-38,39-27-15-5-16-28-39)40-29-17-6-18-30-40/h1-30,33-34H |
| InChIK | SYLGWZXRWURIRW-UHFFFAOYSA-N |
| TotalMolweight | 654.692 |
| Molweight | 654.692 |
| MonoisotopicMass | 654.21022 |
| CLogP | 9.74 |
| CLogS | -10.974 |
| H Acceptors | 4 |
| TotalSurfaceArea | 522.88 |
| Relative PSA | 0.11112 |
| PolarSurfaceArea | 91.92 |
| Druglikeness | -11.678 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.33333 |
| Fragments | 1 |
| Non HAtoms | 48 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 9 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 6 |
| Aromatic Atoms | 36 |
| Sp3Atoms | 2 |
| Symmetricatoms | 38 |
| StereoCon |
Click to Load Molecule:
1 - (3Z)-3-[(Z)-[2-cyano-2-(triphenyl-lambda5-phosphanylidene)ethylidene]hydrazinylidene]-2-(triphenyl-lambda5-phosphanylidene)propanenitrile | 2 - (3Z)-3-[(Z)-[2-cyano-2-(triphenyl-lambda5-phosphanylidene)ethylidene]hydrazinylidene]-2-(triphenyl-lambda5-phosphanylidene)propanenitrile