| MolName | 2,4-dinitro-N-[(Z)-[1-[(4-nitrophenyl)methyl]indol-3-yl]methylideneamino]aniline |
| MolecularFormula | C22H16N6O6 |
| Smiles | [O-][N+](c1ccc(Cn2c(cccc3)c3c(/C=N\Nc(ccc([N+]([O-])=O)c3)c3[N+]([O-])=O)c2)cc1)=O |
| InChI | InChI=1S/C22H16N6O6/c29-26(30)17-7-5-15(6-8-17)13-25-14-16(19-3-1-2-4-21(19)25)12-23-24-20-10-9-18(27(31)32)11-22(20)28(33)34/h1-12,14,24H,13H2 |
| InChIK | SZJHDQHINNGBTL-UHFFFAOYSA-N |
| TotalMolweight | 460.405 |
| Molweight | 460.405 |
| MonoisotopicMass | 460.113134 |
| CLogP | 3.6058 |
| CLogS | -5.507 |
| H Acceptors | 12 |
| H Donors | 1 |
| TotalSurfaceArea | 337.57 |
| Relative PSA | 0.35874 |
| PolarSurfaceArea | 166.78 |
| Druglikeness | -0.97103 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.55882 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| AcidicOxygens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 2,4-dinitro-N-[(Z)-[1-[(4-nitrophenyl)methyl]indol-3-yl]methylideneamino]aniline | 2 - 2,4-dinitro-N-[(Z)-[1-[(4-nitrophenyl)methyl]indol-3-yl]methylideneamino]aniline