| MolName | 4-N,6-N-diphenyl-2-N-[(Z)-pyridin-4-ylmethylideneamino]-1,3,5-triazine-2,4,6-triamine |
| MolecularFormula | C21H18N8 |
| Smiles | C(c1ccncc1)=N\Nc1nc(Nc2ccccc2)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C21H18N8/c1-3-7-17(8-4-1)24-19-26-20(25-18-9-5-2-6-10-18)28-21(27-19)29-23-15-16-11-13-22-14-12-16/h1-15H,(H3,24,25,26,27,28,29) |
| InChIK | SZVXXWRSXUHUSZ-UHFFFAOYSA-N |
| TotalMolweight | 382.43 |
| Molweight | 382.43 |
| MonoisotopicMass | 382.165442 |
| CLogP | 6.3224 |
| CLogS | -5.696 |
| H Acceptors | 8 |
| H Donors | 3 |
| TotalSurfaceArea | 306.72 |
| Relative PSA | 0.29268 |
| PolarSurfaceArea | 100.01 |
| Druglikeness | 2.5594 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.51724 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Symmetricatoms | 13 |
| Aromatic Nitrogens | 4 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 4-N,6-N-diphenyl-2-N-[(Z)-pyridin-4-ylmethylideneamino]-1,3,5-triazine-2,4,6-triamine | 2 - 4-N,6-N-diphenyl-2-N-[(Z)-pyridin-4-ylmethylideneamino]-1,3,5-triazine-2,4,6-triamine