| MolName | N'-[(Z)-[2-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-N-cyclopropyloxamide |
| MolecularFormula | C19H18N3O3Cl |
| Smiles | O=C(C(N/N=C\c(cccc1)c1OCc(cccc1)c1Cl)=O)NC1CC1 |
| InChI | InChI=1S/C19H18ClN3O3/c20-16-7-3-1-6-14(16)12-26-17-8-4-2-5-13(17)11-21-23-19(25)18(24)22-15-9-10-15/h1-8,11,15H,9-10,12H2,(H,22,24)(H,23,25) |
| InChIK | SZXSVUXCTMBWDK-UHFFFAOYSA-N |
| TotalMolweight | 371.823 |
| Molweight | 371.823 |
| MonoisotopicMass | 371.103669 |
| CLogP | 2.919 |
| CLogS | -4.859 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 281.9 |
| Relative PSA | 0.25012 |
| PolarSurfaceArea | 79.79 |
| Druglikeness | 4.3271 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.61538 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 5 |
| Symmetricatoms | 1 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N'-[(Z)-[2-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-N-cyclopropyloxamide | 2 - N'-[(Z)-[2-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-N-cyclopropyloxamide