| MolName | 4-hydroxy-N-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]benzamide |
| MolecularFormula | C21H18N2O3 |
| Smiles | Oc(cc1)ccc1C(N/N=C\c(cc1)ccc1OCc1ccccc1)=O |
| InChI | InChI=1S/C21H18N2O3/c24-19-10-8-18(9-11-19)21(25)23-22-14-16-6-12-20(13-7-16)26-15-17-4-2-1-3-5-17/h1-14,24H,15H2,(H,23,25) |
| InChIK | SZXWHGDCUFXJLQ-UHFFFAOYSA-N |
| TotalMolweight | 346.385 |
| Molweight | 346.385 |
| MonoisotopicMass | 346.131743 |
| CLogP | 4.204 |
| CLogS | -4.766 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 276.86 |
| Relative PSA | 0.2135 |
| PolarSurfaceArea | 70.92 |
| Druglikeness | 4.0044 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.73077 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 3 |
| Symmetricatoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - 4-hydroxy-N-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]benzamide | 2 - 4-hydroxy-N-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]benzamide