| MolName | N-[2-[(2Z)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-2-oxoethyl]-2,2-diphenylacetamide |
| MolecularFormula | C23H19N3O2Cl2 |
| Smiles | O=C(CNC(C(c1ccccc1)c1ccccc1)=O)N/N=C\c(ccc(Cl)c1)c1Cl |
| InChI | InChI=1S/C23H19Cl2N3O2/c24-19-12-11-18(20(25)13-19)14-27-28-21(29)15-26-23(30)22(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-14,22H,15H2,(H,26,30)(H,28,29) |
| InChIK | TTWYHCJQZZABCG-UHFFFAOYSA-N |
| TotalMolweight | 440.329 |
| Molweight | 440.329 |
| MonoisotopicMass | 439.085431 |
| CLogP | 5.023 |
| CLogS | -6.074 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 333.06 |
| Relative PSA | 0.18168 |
| PolarSurfaceArea | 70.56 |
| Druglikeness | 6.3372 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.56667 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 8 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[2-[(2Z)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-2-oxoethyl]-2,2-diphenylacetamide | 2 - N-[2-[(2Z)-2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-2-oxoethyl]-2,2-diphenylacetamide