| MolName | (E)-N-[2-[(2Z)-2-(1,3-benzodioxol-5-ylmethylidene)hydrazinyl]-2-oxoethyl]-3-phenylprop-2-enamide |
| MolecularFormula | C19H17N3O4 |
| Smiles | O=C(CNC(/C=C/c1ccccc1)=O)N/N=C\c(cc1)cc2c1OCO2 |
| InChI | InChI=1S/C19H17N3O4/c23-18(9-7-14-4-2-1-3-5-14)20-12-19(24)22-21-11-15-6-8-16-17(10-15)26-13-25-16/h1-11H,12-13H2,(H,20,23)(H,22,24) |
| InChIK | TUEPCZVHHCOXMQ-UHFFFAOYSA-N |
| TotalMolweight | 351.361 |
| Molweight | 351.361 |
| MonoisotopicMass | 351.121907 |
| CLogP | 2.7259 |
| CLogS | -4.569 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 276.72 |
| Relative PSA | 0.29094 |
| PolarSurfaceArea | 89.02 |
| Druglikeness | 3.8655 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.69231 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - (E)-N-[2-[(2Z)-2-(1,3-benzodioxol-5-ylmethylidene)hydrazinyl]-2-oxoethyl]-3-phenylprop-2-enamide | 2 - (E)-N-[2-[(2Z)-2-(1,3-benzodioxol-5-ylmethylidene)hydrazinyl]-2-oxoethyl]-3-phenylprop-2-enamide