| MolName | 2-[2-[(Z)-[[2-[[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]hydrazinylidene]methyl]phenoxy]acetate |
| MolecularFormula | C24H19N4O4S3 |
| Smiles | [O-]C(COc1c(/C=N\NC(CSc2nnc(SCc3cccc4ccccc34)s2)=O)cccc1)=O |
| InChI | InChI=1S/C24H20N4O4S3/c29-21(26-25-12-17-7-2-4-11-20(17)32-13-22(30)31)15-34-24-28-27-23(35-24)33-14-18-9-5-8-16-6-1-3-10-19(16)18/h1-12H,13-15H2,(H,26,29)(H,30,31)/p-1 |
| InChIK | TUISUHYARYBUMY-UHFFFAOYSA-M |
| TotalMolweight | 523.637 |
| Molweight | 523.637 |
| MonoisotopicMass | 523.056841 |
| CLogP | 2.5914 |
| CLogS | -7.739 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 386.35 |
| Relative PSA | 0.38983 |
| PolarSurfaceArea | 195.44 |
| Druglikeness | 5.0187 |
| Mutagenic | low |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.62857 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 11 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 7 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[2-[(Z)-[[2-[[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]hydrazinylidene]methyl]phenoxy]acetate | 2 - 2-[2-[(Z)-[[2-[[5-(naphthalen-1-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]hydrazinylidene]methyl]phenoxy]acetate