| MolName | 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[(Z)-thiophen-2-ylmethylideneamino]-1,3-thiazol-2-amine |
| MolecularFormula | C16H13N3O2S2 |
| Smiles | C1Oc(ccc(-c2csc(N/N=C\c3cccs3)n2)c2)c2OC1 |
| InChI | InChI=1S/C16H13N3O2S2/c1-2-12(22-7-1)9-17-19-16-18-13(10-23-16)11-3-4-14-15(8-11)21-6-5-20-14/h1-4,7-10H,5-6H2,(H,18,19) |
| InChIK | TUOYZZFEIVXLFF-UHFFFAOYSA-N |
| TotalMolweight | 343.43 |
| Molweight | 343.43 |
| MonoisotopicMass | 343.044917 |
| CLogP | 6.0618 |
| CLogS | -4.852 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 253.66 |
| Relative PSA | 0.37318 |
| PolarSurfaceArea | 112.22 |
| Druglikeness | -2.0113 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.65217 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 4 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[(Z)-thiophen-2-ylmethylideneamino]-1,3-thiazol-2-amine | 2 - 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[(Z)-thiophen-2-ylmethylideneamino]-1,3-thiazol-2-amine