| MolName | 2-[4-[(Z)-[[2-[(2-bromophenyl)methylsulfanyl]acetyl]hydrazinylidene]methyl]phenoxy]acetamide |
| MolecularFormula | C18H18N3O3BrS |
| Smiles | NC(COc1ccc(/C=N\NC(CSCc(cccc2)c2Br)=O)cc1)=O |
| InChI | InChI=1S/C18H18BrN3O3S/c19-16-4-2-1-3-14(16)11-26-12-18(24)22-21-9-13-5-7-15(8-6-13)25-10-17(20)23/h1-9H,10-12H2,(H2,20,23)(H,22,24) |
| InChIK | TUSQAFZQFQRBDG-UHFFFAOYSA-N |
| TotalMolweight | 436.329 |
| Molweight | 436.329 |
| MonoisotopicMass | 435.025223 |
| CLogP | 2.7786 |
| CLogS | -5.21 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 300.66 |
| Relative PSA | 0.30536 |
| PolarSurfaceArea | 119.08 |
| Druglikeness | 3.0983 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.73077 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 9 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 5 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[4-[(Z)-[[2-[(2-bromophenyl)methylsulfanyl]acetyl]hydrazinylidene]methyl]phenoxy]acetamide | 2 - 2-[4-[(Z)-[[2-[(2-bromophenyl)methylsulfanyl]acetyl]hydrazinylidene]methyl]phenoxy]acetamide