| MolName | N-[(Z)-(2-chloro-5-nitrophenyl)methylideneamino]-5-thiophen-2-yl-1H-pyrazole-3-carboxamide |
| MolecularFormula | C15H10N5O3ClS |
| Smiles | [O-][N+](c(cc1)cc(/C=N\NC(c2n[nH]c(-c3cccs3)c2)=O)c1Cl)=O |
| InChI | InChI=1S/C15H10ClN5O3S/c16-11-4-3-10(21(23)24)6-9(11)8-17-20-15(22)13-7-12(18-19-13)14-2-1-5-25-14/h1-8H,(H,18,19)(H,20,22) |
| InChIK | TVFAVJOOWBKJBA-UHFFFAOYSA-N |
| TotalMolweight | 375.795 |
| Molweight | 375.795 |
| MonoisotopicMass | 375.019287 |
| CLogP | 2.6073 |
| CLogS | -5.213 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 270.11 |
| Relative PSA | 0.41372 |
| PolarSurfaceArea | 144.2 |
| Druglikeness | 2.4854 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 1 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2-chloro-5-nitrophenyl)methylideneamino]-5-thiophen-2-yl-1H-pyrazole-3-carboxamide | 2 - N-[(Z)-(2-chloro-5-nitrophenyl)methylideneamino]-5-thiophen-2-yl-1H-pyrazole-3-carboxamide