| MolName | (Z)-N-[3-[(4-chlorophenyl)methylsulfanyl]-1,2,4-triazol-4-yl]-1-naphthalen-1-ylmethanimine |
| MolecularFormula | C20H15N4ClS |
| Smiles | Clc1ccc(CSc2nncn2/N=C\c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C20H15ClN4S/c21-18-10-8-15(9-11-18)13-26-20-24-22-14-25(20)23-12-17-6-3-5-16-4-1-2-7-19(16)17/h1-12,14H,13H2 |
| InChIK | TVKWSKXQAZQMJO-UHFFFAOYSA-N |
| TotalMolweight | 378.886 |
| Molweight | 378.886 |
| MonoisotopicMass | 378.070593 |
| CLogP | 5.2322 |
| CLogS | -8.85 |
| H Acceptors | 4 |
| TotalSurfaceArea | 285.53 |
| Relative PSA | 0.20247 |
| PolarSurfaceArea | 68.37 |
| Druglikeness | 3.9939 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.61538 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-N-[3-[(4-chlorophenyl)methylsulfanyl]-1,2,4-triazol-4-yl]-1-naphthalen-1-ylmethanimine | 2 - (Z)-N-[3-[(4-chlorophenyl)methylsulfanyl]-1,2,4-triazol-4-yl]-1-naphthalen-1-ylmethanimine