| MolName | 4-(2,4-dichlorophenyl)-N-[(Z)-(2,5-dichlorophenyl)methylideneamino]-1,3-thiazol-2-amine |
| MolecularFormula | C16H9N3Cl4S |
| Smiles | Clc(cc1)cc(/C=N\Nc2nc(-c(ccc(Cl)c3)c3Cl)cs2)c1Cl |
| InChI | InChI=1S/C16H9Cl4N3S/c17-10-2-4-13(19)9(5-10)7-21-23-16-22-15(8-24-16)12-3-1-11(18)6-14(12)20/h1-8H,(H,22,23) |
| InChIK | TVOOJTSDAPXGGQ-UHFFFAOYSA-N |
| TotalMolweight | 417.146 |
| Molweight | 417.146 |
| MonoisotopicMass | 414.927125 |
| CLogP | 8.6404 |
| CLogS | -7.604 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 285.38 |
| Relative PSA | 0.19027 |
| PolarSurfaceArea | 65.52 |
| Druglikeness | 4.0061 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.625 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-(2,4-dichlorophenyl)-N-[(Z)-(2,5-dichlorophenyl)methylideneamino]-1,3-thiazol-2-amine | 2 - 4-(2,4-dichlorophenyl)-N-[(Z)-(2,5-dichlorophenyl)methylideneamino]-1,3-thiazol-2-amine