| MolName | (3S)-N-[2-[(2Z)-2-[(5-bromo-2-phenylmethoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
| MolecularFormula | C25H22N3O5Br |
| Smiles | O=C(CNC([C@H]1Oc(cccc2)c2OC1)=O)N/N=C\c(cc(cc1)Br)c1OCc1ccccc1 |
| InChI | InChI=1S/C25H22BrN3O5/c26-19-10-11-20(32-15-17-6-2-1-3-7-17)18(12-19)13-28-29-24(30)14-27-25(31)23-16-33-21-8-4-5-9-22(21)34-23/h1-13,23H,14-16H2,(H,27,31)(H,29,30)/t23-/m0/s1 |
| InChIK | TVTMBXUKLIHUCY-QHCPKHFHSA-N |
| TotalMolweight | 524.37 |
| Molweight | 524.37 |
| MonoisotopicMass | 523.074283 |
| CLogP | 3.9007 |
| CLogS | -5.685 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 364.87 |
| Relative PSA | 0.24806 |
| PolarSurfaceArea | 98.25 |
| Druglikeness | 4.4181 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.61765 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| StereoCenters | 1 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 7 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - (3S)-N-[2-[(2Z)-2-[(5-bromo-2-phenylmethoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-2,3-dihydro-1,4-benzodioxine-3-carboxamide | 2 - (3S)-N-[2-[(2Z)-2-[(5-bromo-2-phenylmethoxyphenyl)methylidene]hydrazinyl]-2-oxoethyl]-2,3-dihydro-1,4-benzodioxine-3-carboxamide