| MolName | 2-[2-[(Z)-[[2-(4-bromonaphthalen-1-yl)acetyl]hydrazinylidene]methyl]phenoxy]acetic acid |
| MolecularFormula | C21H17N2O4Br |
| Smiles | OC(COc1c(/C=N\NC(Cc(c2ccccc22)ccc2Br)=O)cccc1)=O |
| InChI | InChI=1S/C21H17BrN2O4/c22-18-10-9-14(16-6-2-3-7-17(16)18)11-20(25)24-23-12-15-5-1-4-8-19(15)28-13-21(26)27/h1-10,12H,11,13H2,(H,24,25)(H,26,27) |
| InChIK | TWCBYANHVINUMV-UHFFFAOYSA-N |
| TotalMolweight | 441.28 |
| Molweight | 441.28 |
| MonoisotopicMass | 440.037169 |
| CLogP | 4.1793 |
| CLogS | -5.919 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 301.84 |
| Relative PSA | 0.23903 |
| PolarSurfaceArea | 87.99 |
| Druglikeness | 2.4546 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.57143 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 4 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[2-[(Z)-[[2-(4-bromonaphthalen-1-yl)acetyl]hydrazinylidene]methyl]phenoxy]acetic acid | 2 - 2-[2-[(Z)-[[2-(4-bromonaphthalen-1-yl)acetyl]hydrazinylidene]methyl]phenoxy]acetic acid