| MolName | 6-N-naphthalen-1-yl-4-N-[(Z)-(4-nitrophenyl)methylideneamino]-2-N,2-N-diphenyl-1,3,5-triazine-2,4,6-triamine |
| MolecularFormula | C32H24N8O2 |
| Smiles | [O-][N+](c1ccc(/C=N\Nc2nc(N(c3ccccc3)c3ccccc3)nc(Nc3cccc4ccccc34)n2)cc1)=O |
| InChI | InChI=1S/C32H24N8O2/c41-40(42)27-20-18-23(19-21-27)22-33-38-31-35-30(34-29-17-9-11-24-10-7-8-16-28(24)29)36-32(37-31)39(25-12-3-1-4-13-25)26-14-5-2-6-15-26/h1-22H,(H2,34,35,36,37,38) |
| InChIK | TWHKEJJJADSSOL-UHFFFAOYSA-N |
| TotalMolweight | 552.597 |
| Molweight | 552.597 |
| MonoisotopicMass | 552.202222 |
| CLogP | 8.1489 |
| CLogS | -11.155 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 424.83 |
| Relative PSA | 0.23847 |
| PolarSurfaceArea | 124.15 |
| Druglikeness | -2.17 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.42857 |
| Fragments | 1 |
| Non HAtoms | 42 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 9 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 6 |
| Aromatic Atoms | 34 |
| Sp3Atoms | 1 |
| Symmetricatoms | 10 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 6-N-naphthalen-1-yl-4-N-[(Z)-(4-nitrophenyl)methylideneamino]-2-N,2-N-diphenyl-1,3,5-triazine-2,4,6-triamine | 2 - 6-N-naphthalen-1-yl-4-N-[(Z)-(4-nitrophenyl)methylideneamino]-2-N,2-N-diphenyl-1,3,5-triazine-2,4,6-triamine