| MolName | N-[(Z)-(4-nitrophenyl)methylideneamino]-2-[4-[2-[(2Z)-2-[(4-nitrophenyl)methylidene]hydrazinyl]-2-oxoethoxy]phenoxy]acetamide |
| MolecularFormula | C24H20N6O8 |
| Smiles | [O-][N+](c1ccc(/C=N\NC(COc(cc2)ccc2OCC(N/N=C\c(cc2)ccc2[N+]([O-])=O)=O)=O)cc1)=O |
| InChI | InChI=1S/C24H20N6O8/c31-23(27-25-13-17-1-5-19(6-2-17)29(33)34)15-37-21-9-11-22(12-10-21)38-16-24(32)28-26-14-18-3-7-20(8-4-18)30(35)36/h1-14H,15-16H2,(H,27,31)(H,28,32) |
| InChIK | TWSKKELNTKQXRL-UHFFFAOYSA-N |
| TotalMolweight | 520.457 |
| Molweight | 520.457 |
| MonoisotopicMass | 520.134264 |
| CLogP | 2.0502 |
| CLogS | -6.306 |
| H Acceptors | 14 |
| H Donors | 2 |
| TotalSurfaceArea | 395.58 |
| Relative PSA | 0.38642 |
| PolarSurfaceArea | 193.02 |
| Druglikeness | -0.93238 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.73684 |
| Fragments | 1 |
| Non HAtoms | 38 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 12 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 6 |
| Symmetricatoms | 22 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4-nitrophenyl)methylideneamino]-2-[4-[2-[(2Z)-2-[(4-nitrophenyl)methylidene]hydrazinyl]-2-oxoethoxy]phenoxy]acetamide | 2 - N-[(Z)-(4-nitrophenyl)methylideneamino]-2-[4-[2-[(2Z)-2-[(4-nitrophenyl)methylidene]hydrazinyl]-2-oxoethoxy]phenoxy]acetamide