| MolName | [4-bromo-2-[(Z)-[[2-(naphthalen-1-ylamino)acetyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate |
| MolecularFormula | C26H19N3O3Br2 |
| Smiles | O=C(CNc1cccc2ccccc12)N/N=C\c(cc(cc1)Br)c1OC(c(cc1)ccc1Br)=O |
| InChI | InChI=1S/C26H19Br2N3O3/c27-20-10-8-18(9-11-20)26(33)34-24-13-12-21(28)14-19(24)15-30-31-25(32)16-29-23-7-3-5-17-4-1-2-6-22(17)23/h1-15,29H,16H2,(H,31,32) |
| InChIK | TWVOJQXIKPTCKN-UHFFFAOYSA-N |
| TotalMolweight | 581.263 |
| Molweight | 581.263 |
| MonoisotopicMass | 578.979314 |
| CLogP | 6.5688 |
| CLogS | -8.287 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 371.58 |
| Relative PSA | 0.18976 |
| PolarSurfaceArea | 79.79 |
| Druglikeness | 2.8805 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.58824 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Amines | 1 |
| Aromatic Amines | 1 |
| StereoCon |
Click to Load Molecule:
1 - [4-bromo-2-[(Z)-[[2-(naphthalen-1-ylamino)acetyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate | 2 - [4-bromo-2-[(Z)-[[2-(naphthalen-1-ylamino)acetyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate