| MolName | N-[(Z)-(2-chloro-6-fluorophenyl)methylideneamino]-2-pyrrol-1-ylbenzamide |
| MolecularFormula | C18H13N3OClF |
| Smiles | O=C(c(cccc1)c1-n1cccc1)N/N=C\c(c(F)ccc1)c1Cl |
| InChI | InChI=1S/C18H13ClFN3O/c19-15-7-5-8-16(20)14(15)12-21-22-18(24)13-6-1-2-9-17(13)23-10-3-4-11-23/h1-12H,(H,22,24) |
| InChIK | TXDKKKVSSBIOSX-UHFFFAOYSA-N |
| TotalMolweight | 341.772 |
| Molweight | 341.772 |
| MonoisotopicMass | 341.073117 |
| CLogP | 4.0933 |
| CLogS | -7.084 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 257.72 |
| Relative PSA | 0.16638 |
| PolarSurfaceArea | 46.39 |
| Druglikeness | 3.7692 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.54167 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2-chloro-6-fluorophenyl)methylideneamino]-2-pyrrol-1-ylbenzamide | 2 - N-[(Z)-(2-chloro-6-fluorophenyl)methylideneamino]-2-pyrrol-1-ylbenzamide