| MolName | N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]-2-(1,2,4-triazol-1-yl)acetamide |
| MolecularFormula | C13H13N5O |
| Smiles | O=C(Cn1ncnc1)N/N=C\C=C\c1ccccc1 |
| InChI | InChI=1S/C13H13N5O/c19-13(9-18-11-14-10-16-18)17-15-8-4-7-12-5-2-1-3-6-12/h1-8,10-11H,9H2,(H,17,19) |
| InChIK | TXRDCERPMWTCNI-UHFFFAOYSA-N |
| TotalMolweight | 255.28 |
| Molweight | 255.28 |
| MonoisotopicMass | 255.11201 |
| CLogP | 0.6531 |
| CLogS | -2.624 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 213.97 |
| Relative PSA | 0.30294 |
| PolarSurfaceArea | 72.17 |
| Druglikeness | 6.465 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.73684 |
| Fragments | 1 |
| Non HAtoms | 19 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]-2-(1,2,4-triazol-1-yl)acetamide | 2 - N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]-2-(1,2,4-triazol-1-yl)acetamide