| MolName | (Z)-1-[3-(trifluoromethyl)phenyl]-N-[8-[(Z)-[3-(trifluoromethyl)phenyl]methylideneamino]-5,11-dioxa-2,4,6,8,10,12-hexazatricyclo[7.3.0.03,7]dodeca-1(12),3,6,9-tetraen-2-yl]methanimine |
| MolecularFormula | C20H10N8O2F6 |
| Smiles | FC(c1cccc(/C=N\N(c2nonc22)c3nonc3N2/N=C\c2cccc(C(F)(F)F)c2)c1)(F)F |
| InChI | InChI=1S/C20H10F6N8O2/c21-19(22,23)13-5-1-3-11(7-13)9-27-33-15-17(31-35-29-15)34(18-16(33)30-36-32-18)28-10-12-4-2-6-14(8-12)20(24,25)26/h1-10H |
| InChIK | TXVQKSBIOROZQW-UHFFFAOYSA-N |
| TotalMolweight | 508.341 |
| Molweight | 508.341 |
| MonoisotopicMass | 508.08309 |
| CLogP | 7.2632 |
| CLogS | -8.892 |
| H Acceptors | 10 |
| TotalSurfaceArea | 342.5 |
| Relative PSA | 0.29845 |
| PolarSurfaceArea | 109.04 |
| Druglikeness | -2.9624 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 16 |
| Electronegative Atoms | 16 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 2 |
| Symmetricatoms | 22 |
| Aromatic Nitrogens | 4 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-[3-(trifluoromethyl)phenyl]-N-[8-[(Z)-[3-(trifluoromethyl)phenyl]methylideneamino]-5,11-dioxa-2,4,6,8,10,12-hexazatricyclo[7.3.0.03,7]dodeca-1(12),3,6,9-tetraen-2-yl]methanimine | 2 - (Z)-1-[3-(trifluoromethyl)phenyl]-N-[8-[(Z)-[3-(trifluoromethyl)phenyl]methylideneamino]-5,11-dioxa-2,4,6,8,10,12-hexazatricyclo[7.3.0.03,7]dodeca-1(12),3,6,9-tetraen-2-yl]methanimine