| MolName | N-[(Z)-(4-nitrophenyl)methylideneamino]-2-(14-phenyl-8,10,12,13,15,16-hexazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-yl)acetamide |
| MolecularFormula | C25H17N9O3 |
| Smiles | [O-][N+](c1ccc(/C=N\NC(Cn2c3nc4nnc(-c5ccccc5)n4nc3c3c2cccc3)=O)cc1)=O |
| InChI | InChI=1S/C25H17N9O3/c35-21(28-26-14-16-10-12-18(13-11-16)34(36)37)15-32-20-9-5-4-8-19(20)22-24(32)27-25-30-29-23(33(25)31-22)17-6-2-1-3-7-17/h1-14H,15H2,(H,28,35) |
| InChIK | TYMIAHJIRLQQLT-UHFFFAOYSA-N |
| TotalMolweight | 491.47 |
| Molweight | 491.47 |
| MonoisotopicMass | 491.145436 |
| CLogP | 2.0829 |
| CLogS | -5.487 |
| H Acceptors | 12 |
| H Donors | 1 |
| TotalSurfaceArea | 362.87 |
| Relative PSA | 0.34483 |
| PolarSurfaceArea | 148.18 |
| Druglikeness | 2.2145 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.56757 |
| Fragments | 1 |
| Non HAtoms | 37 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 6 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 6 |
| Aromatic Atoms | 28 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 6 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4-nitrophenyl)methylideneamino]-2-(14-phenyl-8,10,12,13,15,16-hexazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-yl)acetamide | 2 - N-[(Z)-(4-nitrophenyl)methylideneamino]-2-(14-phenyl-8,10,12,13,15,16-hexazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-yl)acetamide