| MolName | 2,4-dinitro-N-[(Z)-2-(1-phenyltetrazol-5-yl)ethylideneamino]aniline |
| MolecularFormula | C15H12N8O4 |
| Smiles | [O-][N+](c(cc1)cc([N+]([O-])=O)c1N/N=C\Cc1nnnn1-c1ccccc1)=O |
| InChI | InChI=1S/C15H12N8O4/c24-22(25)12-6-7-13(14(10-12)23(26)27)17-16-9-8-15-18-19-20-21(15)11-4-2-1-3-5-11/h1-7,9-10,17H,8H2 |
| InChIK | TYOOADUTIROREY-UHFFFAOYSA-N |
| TotalMolweight | 368.312 |
| Molweight | 368.312 |
| MonoisotopicMass | 368.098152 |
| CLogP | 1.473 |
| CLogS | -3.539 |
| H Acceptors | 12 |
| H Donors | 1 |
| TotalSurfaceArea | 275.58 |
| Relative PSA | 0.44847 |
| PolarSurfaceArea | 159.63 |
| Druglikeness | -3.5489 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.59259 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 4 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2,4-dinitro-N-[(Z)-2-(1-phenyltetrazol-5-yl)ethylideneamino]aniline | 2 - 2,4-dinitro-N-[(Z)-2-(1-phenyltetrazol-5-yl)ethylideneamino]aniline