| MolName | 4-[(2,2-dioxo-2lambda6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)methyl]-N-[(Z)-(2-nitrophenyl)methylideneamino]benzamide |
| MolecularFormula | C25H18N4O5S |
| Smiles | [O-][N+](c1c(/C=N\NC(c2ccc(CN(c3c(c4ccc5)c5ccc3)S4(=O)=O)cc2)=O)cccc1)=O |
| InChI | InChI=1S/C25H18N4O5S/c30-25(27-26-15-20-5-1-2-8-21(20)29(31)32)19-13-11-17(12-14-19)16-28-22-9-3-6-18-7-4-10-23(24(18)22)35(28,33)34/h1-15H,16H2,(H,27,30) |
| InChIK | TZHXYDKNDMPVPY-UHFFFAOYSA-N |
| TotalMolweight | 486.507 |
| Molweight | 486.507 |
| MonoisotopicMass | 486.099791 |
| CLogP | 3.875 |
| CLogS | -7.467 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 344.16 |
| Relative PSA | 0.28638 |
| PolarSurfaceArea | 133.04 |
| Druglikeness | -6.2171 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.51429 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 3 |
| Symmetricatoms | 3 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(2,2-dioxo-2lambda6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)methyl]-N-[(Z)-(2-nitrophenyl)methylideneamino]benzamide | 2 - 4-[(2,2-dioxo-2lambda6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)methyl]-N-[(Z)-(2-nitrophenyl)methylideneamino]benzamide