| MolName | (5Z)-5-[(6-chloro-1,3-benzodioxol-5-yl)methylidene]-3-[(Z)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one |
| MolecularFormula | C19H10N2O5Cl2S2 |
| Smiles | O=C(/C(/SC1=S)=C/c(cc2OCOc2c2)c2Cl)N1N=Cc(cc1OCOc1c1)c1Cl |
| InChI | InChI=1S/C19H10Cl2N2O5S2/c20-11-4-15-13(25-7-27-15)1-9(11)3-17-18(24)23(19(29)30-17)22-6-10-2-14-16(5-12(10)21)28-8-26-14/h1-6H,7-8H2 |
| InChIK | TZYXSANMBNHZOO-UHFFFAOYSA-N |
| TotalMolweight | 481.335 |
| Molweight | 481.335 |
| MonoisotopicMass | 479.940817 |
| CLogP | 4.49 |
| CLogS | -7.989 |
| H Acceptors | 7 |
| TotalSurfaceArea | 318.6 |
| Relative PSA | 0.35653 |
| PolarSurfaceArea | 126.98 |
| Druglikeness | 4.785 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.53333 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 3 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 8 |
| StereoCon |
Click to Load Molecule:
1 - (5Z)-5-[(6-chloro-1,3-benzodioxol-5-yl)methylidene]-3-[(Z)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one | 2 - (5Z)-5-[(6-chloro-1,3-benzodioxol-5-yl)methylidene]-3-[(Z)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one