| MolName | 4-chloro-5-[(Z)-[(Z)-(4-chloro-2-oxo-3-phenyl-1,3-thiazol-5-yl)methylidenehydrazinylidene]methyl]-3-phenyl-1,3-thiazol-2-one |
| MolecularFormula | C20H12N4O2Cl2S2 |
| Smiles | O=C(N1c2ccccc2)SC(/C=N\N=C/C(SC(N2c3ccccc3)=O)=C2Cl)=C1Cl |
| InChI | InChI=1S/C20H12Cl2N4O2S2/c21-17-15(29-19(27)25(17)13-7-3-1-4-8-13)11-23-24-12-16-18(22)26(20(28)30-16)14-9-5-2-6-10-14/h1-12H |
| InChIK | UAFONNQJZLDZIY-UHFFFAOYSA-N |
| TotalMolweight | 475.379 |
| Molweight | 475.379 |
| MonoisotopicMass | 473.97787 |
| CLogP | 5.6804 |
| CLogS | -8.39 |
| H Acceptors | 6 |
| TotalSurfaceArea | 323.3 |
| Relative PSA | 0.28203 |
| PolarSurfaceArea | 115.94 |
| Druglikeness | 4.4378 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | polar activated DB; dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| Symmetricatoms | 17 |
| Amides | 2 |
| StereoCon |
Click to Load Molecule:
1 - 4-chloro-5-[(Z)-[(Z)-(4-chloro-2-oxo-3-phenyl-1,3-thiazol-5-yl)methylidenehydrazinylidene]methyl]-3-phenyl-1,3-thiazol-2-one | 2 - 4-chloro-5-[(Z)-[(Z)-(4-chloro-2-oxo-3-phenyl-1,3-thiazol-5-yl)methylidenehydrazinylidene]methyl]-3-phenyl-1,3-thiazol-2-one