| MolName | 2-[(2E)-3-(4-hydroxyphenyl)-4-oxo-2-[(E)-[(Z)-3-phenylprop-2-enylidene]hydrazinylidene]-1,3-thiazolidin-5-yl]acetic acid |
| MolecularFormula | C20H17N3O4S |
| Smiles | OC(CC(C(N1c(cc2)ccc2O)=O)S/C1=N/N=C/C=C\c1ccccc1)=O |
| InChI | InChI=1S/C20H17N3O4S/c24-16-10-8-15(9-11-16)23-19(27)17(13-18(25)26)28-20(23)22-21-12-4-7-14-5-2-1-3-6-14/h1-12,17,24H,13H2,(H,25,26)/t17-/m0/s1 |
| InChIK | UBMDNGZRWUVUFR-KRWDZBQOSA-N |
| TotalMolweight | 395.438 |
| Molweight | 395.438 |
| MonoisotopicMass | 395.093977 |
| CLogP | 3.8396 |
| CLogS | -4.931 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 296 |
| Relative PSA | 0.32547 |
| PolarSurfaceArea | 127.86 |
| Druglikeness | 6.137 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.57143 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| StereoCenters | 1 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 5 |
| Symmetricatoms | 4 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon | racemate |
Click to Load Molecule:
1 - 2-[(2E)-3-(4-hydroxyphenyl)-4-oxo-2-[(E)-[(Z)-3-phenylprop-2-enylidene]hydrazinylidene]-1,3-thiazolidin-5-yl]acetic acid | 2 - 2-[(2E)-3-(4-hydroxyphenyl)-4-oxo-2-[(E)-[(Z)-3-phenylprop-2-enylidene]hydrazinylidene]-1,3-thiazolidin-5-yl]acetic acid