| MolName | 4-amino-N'-[(Z)-(5-bromofuran-2-yl)methylideneamino]-1,2,5-oxadiazole-3-carboximidamide |
| MolecularFormula | C8H7N6O2Br |
| Smiles | N/C(/c1nonc1N)=N/N=C\c(o1)ccc1Br |
| InChI | InChI=1S/C8H7BrN6O2/c9-5-2-1-4(16-5)3-12-13-7(10)6-8(11)15-17-14-6/h1-3H,(H2,10,13)(H2,11,15) |
| InChIK | UBXBYJOZMIDJMT-UHFFFAOYSA-N |
| TotalMolweight | 299.088 |
| Molweight | 299.088 |
| MonoisotopicMass | 297.981385 |
| CLogP | 2.1903 |
| CLogS | -3.044 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 193.32 |
| Relative PSA | 0.53652 |
| PolarSurfaceArea | 128.82 |
| Druglikeness | 1.4208 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.64706 |
| Fragments | 1 |
| Non HAtoms | 17 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 4-amino-N'-[(Z)-(5-bromofuran-2-yl)methylideneamino]-1,2,5-oxadiazole-3-carboximidamide | 2 - 4-amino-N'-[(Z)-(5-bromofuran-2-yl)methylideneamino]-1,2,5-oxadiazole-3-carboximidamide