| MolName | N-[(Z)-[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]-3-phenyl-1H-pyrazole-5-carboxamide |
| MolecularFormula | C21H14N4O2Cl2 |
| Smiles | O=C(c1cc(-c2ccccc2)n[nH]1)N/N=C\c1ccc(-c2cccc(Cl)c2Cl)o1 |
| InChI | InChI=1S/C21H14Cl2N4O2/c22-16-8-4-7-15(20(16)23)19-10-9-14(29-19)12-24-27-21(28)18-11-17(25-26-18)13-5-2-1-3-6-13/h1-12H,(H,25,26)(H,27,28) |
| InChIK | UCFCFLQEQNNIEZ-UHFFFAOYSA-N |
| TotalMolweight | 425.274 |
| Molweight | 425.274 |
| MonoisotopicMass | 424.04938 |
| CLogP | 5.0503 |
| CLogS | -7.028 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 315.37 |
| Relative PSA | 0.23807 |
| PolarSurfaceArea | 83.28 |
| Druglikeness | 7.3687 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.62069 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]-3-phenyl-1H-pyrazole-5-carboxamide | 2 - N-[(Z)-[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]-3-phenyl-1H-pyrazole-5-carboxamide