| MolName | N,N'-bis[(Z)-(3,4-dichlorophenyl)methylideneamino]decanediamide |
| MolecularFormula | C24H26N4O2Cl4 |
| Smiles | O=C(CCCCCCCCC(N/N=C\c(cc1)cc(Cl)c1Cl)=O)N/N=C\c(cc1)cc(Cl)c1Cl |
| InChI | InChI=1S/C24H26Cl4N4O2/c25-19-11-9-17(13-21(19)27)15-29-31-23(33)7-5-3-1-2-4-6-8-24(34)32-30-16-18-10-12-20(26)22(28)14-18/h9-16H,1-8H2,(H,31,33)(H,32,34) |
| InChIK | UCNHLOOXGVBIIX-UHFFFAOYSA-N |
| TotalMolweight | 544.308 |
| Molweight | 544.308 |
| MonoisotopicMass | 542.080984 |
| CLogP | 8.5976 |
| CLogS | -9.222 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 412.72 |
| Relative PSA | 0.1745 |
| PolarSurfaceArea | 82.92 |
| Druglikeness | -4.103 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.76471 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 13 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 8 |
| Symmetricatoms | 17 |
| StereoCon |
Click to Load Molecule:
1 - N,N'-bis[(Z)-(3,4-dichlorophenyl)methylideneamino]decanediamide | 2 - N,N'-bis[(Z)-(3,4-dichlorophenyl)methylideneamino]decanediamide