| MolName | (Z)-1-[4-(2-phenoxyethoxy)phenyl]-N-(1,2,4-triazol-4-yl)methanimine |
| MolecularFormula | C17H16N4O2 |
| Smiles | C(COc1ccc(/C=N\n2cnnc2)cc1)Oc1ccccc1 |
| InChI | InChI=1S/C17H16N4O2/c1-2-4-16(5-3-1)22-10-11-23-17-8-6-15(7-9-17)12-20-21-13-18-19-14-21/h1-9,12-14H,10-11H2 |
| InChIK | UDEXZHATGWGODV-UHFFFAOYSA-N |
| TotalMolweight | 308.34 |
| Molweight | 308.34 |
| MonoisotopicMass | 308.127326 |
| CLogP | 2.5833 |
| CLogS | -5.578 |
| H Acceptors | 6 |
| TotalSurfaceArea | 251.78 |
| Relative PSA | 0.23957 |
| PolarSurfaceArea | 61.53 |
| Druglikeness | -3.8214 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.73913 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 4 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-[4-(2-phenoxyethoxy)phenyl]-N-(1,2,4-triazol-4-yl)methanimine | 2 - (Z)-1-[4-(2-phenoxyethoxy)phenyl]-N-(1,2,4-triazol-4-yl)methanimine