| MolName | (Z)-1-(4-chlorophenyl)-N-(5-phenyl-1,3,4-thiadiazol-2-yl)methanimine |
| MolecularFormula | C15H10N3ClS |
| Smiles | Clc1ccc(/C=N\c2nnc(-c3ccccc3)s2)cc1 |
| InChI | InChI=1S/C15H10ClN3S/c16-13-8-6-11(7-9-13)10-17-15-19-18-14(20-15)12-4-2-1-3-5-12/h1-10H |
| InChIK | UDJDDUYXXQTJJM-UHFFFAOYSA-N |
| TotalMolweight | 299.784 |
| Molweight | 299.784 |
| MonoisotopicMass | 299.028394 |
| CLogP | 4.3074 |
| CLogS | -4.398 |
| H Acceptors | 3 |
| TotalSurfaceArea | 226.42 |
| Relative PSA | 0.23766 |
| PolarSurfaceArea | 66.38 |
| Druglikeness | 3.2047 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.7 |
| Fragments | 1 |
| Non HAtoms | 20 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-(4-chlorophenyl)-N-(5-phenyl-1,3,4-thiadiazol-2-yl)methanimine | 2 - (Z)-1-(4-chlorophenyl)-N-(5-phenyl-1,3,4-thiadiazol-2-yl)methanimine