| MolName | 1-(4-amino-1,2,5-oxadiazol-3-yl)-3-[(Z)-(4-nitrophenyl)methylideneamino]urea |
| MolecularFormula | C10H9N7O4 |
| Smiles | Nc1nonc1NC(N/N=C\c(cc1)ccc1[N+]([O-])=O)=O |
| InChI | InChI=1S/C10H9N7O4/c11-8-9(16-21-15-8)13-10(18)14-12-5-6-1-3-7(4-2-6)17(19)20/h1-5H,(H2,11,15)(H2,13,14,16,18) |
| InChIK | UDLHURYLVFUMGG-UHFFFAOYSA-N |
| TotalMolweight | 291.226 |
| Molweight | 291.226 |
| MonoisotopicMass | 291.071603 |
| CLogP | 0.8107 |
| CLogS | -4.066 |
| H Acceptors | 11 |
| H Donors | 3 |
| TotalSurfaceArea | 217.85 |
| Relative PSA | 0.59311 |
| PolarSurfaceArea | 164.25 |
| Druglikeness | -0.27126 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Amides | 1 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-3-[(Z)-(4-nitrophenyl)methylideneamino]urea | 2 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-3-[(Z)-(4-nitrophenyl)methylideneamino]urea