| MolName | N-[(Z)-[4-(2-bromoethoxy)phenyl]methylideneamino]-6-chloro-4-phenylquinazolin-2-amine |
| MolecularFormula | C23H18N4OBrCl |
| Smiles | Clc1ccc2nc(N/N=C\c(cc3)ccc3OCCBr)nc(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C23H18BrClN4O/c24-12-13-30-19-9-6-16(7-10-19)15-26-29-23-27-21-11-8-18(25)14-20(21)22(28-23)17-4-2-1-3-5-17/h1-11,14-15H,12-13H2,(H,27,28,29) |
| InChIK | UDPBJXZSOUTYHP-UHFFFAOYSA-N |
| TotalMolweight | 481.78 |
| Molweight | 481.78 |
| MonoisotopicMass | 480.035249 |
| CLogP | 8.0169 |
| CLogS | -7.292 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 332.69 |
| Relative PSA | 0.16505 |
| PolarSurfaceArea | 59.4 |
| Druglikeness | -3.9675 |
| Mutagenic | low |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | prim. alkyl-bromide/iodide; imine/hydrazone of aldehyde |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 3 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[4-(2-bromoethoxy)phenyl]methylideneamino]-6-chloro-4-phenylquinazolin-2-amine | 2 - N-[(Z)-[4-(2-bromoethoxy)phenyl]methylideneamino]-6-chloro-4-phenylquinazolin-2-amine