| MolName | [2-bromo-4-[(Z)-[[2-(2,4,6-tribromo-3-chlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-nitrobenzoate |
| MolecularFormula | C22H12N3O6Br4Cl |
| Smiles | [O-][N+](c(cc1)ccc1C(Oc(ccc(/C=N\NC(COc(c(Br)c(c(Br)c1)Cl)c1Br)=O)c1)c1Br)=O)=O |
| InChI | InChI=1S/C22H12Br4ClN3O6/c23-14-7-11(1-6-17(14)36-22(32)12-2-4-13(5-3-12)30(33)34)9-28-29-18(31)10-35-21-16(25)8-15(24)20(27)19(21)26/h1-9H,10H2,(H,29,31) |
| InChIK | UDPXLSKRQGCMCU-UHFFFAOYSA-N |
| TotalMolweight | 769.421 |
| Molweight | 769.421 |
| MonoisotopicMass | 764.714808 |
| CLogP | 6.7922 |
| CLogS | -9.503 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 411.87 |
| Relative PSA | 0.24151 |
| PolarSurfaceArea | 122.81 |
| Druglikeness | -2.8167 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde; polyhalo aromatic ring |
| Shape Index | 0.63889 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 9 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - [2-bromo-4-[(Z)-[[2-(2,4,6-tribromo-3-chlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-nitrobenzoate | 2 - [2-bromo-4-[(Z)-[[2-(2,4,6-tribromo-3-chlorophenoxy)acetyl]hydrazinylidene]methyl]phenyl] 4-nitrobenzoate