| MolName | (Z)-1-[3-(difluoromethoxy)phenyl]-N-[(Z)-[3-(difluoromethoxy)phenyl]methylideneamino]methanimine |
| MolecularFormula | C16H12N2O2F4 |
| Smiles | FC(Oc1cccc(/C=N\N=C/c2cccc(OC(F)F)c2)c1)F |
| InChI | InChI=1S/C16H12F4N2O2/c17-15(18)23-13-5-1-3-11(7-13)9-21-22-10-12-4-2-6-14(8-12)24-16(19)20/h1-10,15-16H |
| InChIK | UDWREAOOQVAMQN-UHFFFAOYSA-N |
| TotalMolweight | 340.275 |
| Molweight | 340.275 |
| MonoisotopicMass | 340.08349 |
| CLogP | 5.1244 |
| CLogS | -5.376 |
| H Acceptors | 4 |
| TotalSurfaceArea | 252.94 |
| Relative PSA | 0.17008 |
| PolarSurfaceArea | 43.18 |
| Druglikeness | -1.323 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 7 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 4 |
| Symmetricatoms | 13 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-[3-(difluoromethoxy)phenyl]-N-[(Z)-[3-(difluoromethoxy)phenyl]methylideneamino]methanimine | 2 - (Z)-1-[3-(difluoromethoxy)phenyl]-N-[(Z)-[3-(difluoromethoxy)phenyl]methylideneamino]methanimine