| MolName | (2Z)-2-(phenylhydrazinylidene)-1-[4-[(2Z)-2-(phenylhydrazinylidene)acetyl]phenyl]ethanone |
| MolecularFormula | C22H18N4O2 |
| Smiles | O=C(/C=N\Nc1ccccc1)c(cc1)ccc1C(/C=N\Nc1ccccc1)=O |
| InChI | InChI=1S/C22H18N4O2/c27-21(15-23-25-19-7-3-1-4-8-19)17-11-13-18(14-12-17)22(28)16-24-26-20-9-5-2-6-10-20/h1-16,25-26H |
| InChIK | UDYKGAPTZNMEDF-UHFFFAOYSA-N |
| TotalMolweight | 370.411 |
| Molweight | 370.411 |
| MonoisotopicMass | 370.142976 |
| CLogP | 5.62 |
| CLogS | -4.818 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 300.72 |
| Relative PSA | 0.23949 |
| PolarSurfaceArea | 82.92 |
| Druglikeness | 2.5325 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.71429 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Symmetricatoms | 17 |
| StereoCon |
Click to Load Molecule:
1 - (2Z)-2-(phenylhydrazinylidene)-1-[4-[(2Z)-2-(phenylhydrazinylidene)acetyl]phenyl]ethanone | 2 - (2Z)-2-(phenylhydrazinylidene)-1-[4-[(2Z)-2-(phenylhydrazinylidene)acetyl]phenyl]ethanone