| MolName | 2-[2-[(2Z)-2-[(4-bromophenyl)methylidene]hydrazinyl]-2-oxoethoxy]benzamide |
| MolecularFormula | C16H14N3O3Br |
| Smiles | NC(c(cccc1)c1OCC(N/N=C\c(cc1)ccc1Br)=O)=O |
| InChI | InChI=1S/C16H14BrN3O3/c17-12-7-5-11(6-8-12)9-19-20-15(21)10-23-14-4-2-1-3-13(14)16(18)22/h1-9H,10H2,(H2,18,22)(H,20,21) |
| InChIK | UEMJMBGJLCEHFC-UHFFFAOYSA-N |
| TotalMolweight | 376.209 |
| Molweight | 376.209 |
| MonoisotopicMass | 375.021853 |
| CLogP | 2.589 |
| CLogS | -4.424 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 255.65 |
| Relative PSA | 0.29071 |
| PolarSurfaceArea | 93.78 |
| Druglikeness | 2.7464 |
| Mutagenic | high |
| Tumorigenic | low |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65217 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[2-[(2Z)-2-[(4-bromophenyl)methylidene]hydrazinyl]-2-oxoethoxy]benzamide | 2 - 2-[2-[(2Z)-2-[(4-bromophenyl)methylidene]hydrazinyl]-2-oxoethoxy]benzamide