| MolName | 2-bromo-N-[(Z)-(2,4,6-tribromo-3-hydroxyphenyl)methylideneamino]benzamide |
| MolecularFormula | C14H8N2O2Br4 |
| Smiles | Oc(c(Br)cc(Br)c1/C=N\NC(c(cccc2)c2Br)=O)c1Br |
| InChI | InChI=1S/C14H8Br4N2O2/c15-9-4-2-1-3-7(9)14(22)20-19-6-8-10(16)5-11(17)13(21)12(8)18/h1-6,21H,(H,20,22) |
| InChIK | UENYFJRTBLUKFW-UHFFFAOYSA-N |
| TotalMolweight | 555.846 |
| Molweight | 555.846 |
| MonoisotopicMass | 551.731922 |
| CLogP | 5.7567 |
| CLogS | -6.761 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 267.86 |
| Relative PSA | 0.18334 |
| PolarSurfaceArea | 61.69 |
| Druglikeness | 2.6304 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; polyhalo aromatic ring |
| Shape Index | 0.59091 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-bromo-N-[(Z)-(2,4,6-tribromo-3-hydroxyphenyl)methylideneamino]benzamide | 2 - 2-bromo-N-[(Z)-(2,4,6-tribromo-3-hydroxyphenyl)methylideneamino]benzamide