| MolName | 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[(Z)-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]thiourea |
| MolecularFormula | C22H15N5ClF3S2 |
| Smiles | FC(c(cc1)cc(NC(N/N=C\c2cn(-c3ccccc3)nc2-c2cccs2)=S)c1Cl)(F)F |
| InChI | InChI=1S/C22H15ClF3N5S2/c23-17-9-8-15(22(24,25)26)11-18(17)28-21(32)29-27-12-14-13-31(16-5-2-1-3-6-16)30-20(14)19-7-4-10-33-19/h1-13H,(H2,28,29,32) |
| InChIK | UFAAIIUQLRKCPY-UHFFFAOYSA-N |
| TotalMolweight | 505.975 |
| Molweight | 505.975 |
| MonoisotopicMass | 505.040946 |
| CLogP | 5.989 |
| CLogS | -7.269 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 361.71 |
| Relative PSA | 0.27821 |
| PolarSurfaceArea | 114.57 |
| Druglikeness | -1.5986 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.51515 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[(Z)-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]thiourea | 2 - 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[(Z)-(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]thiourea