| MolName | 4-[(2Z)-2-[(4-chloro-3-nitrophenyl)methylidene]hydrazinyl]-N-(4-chlorophenyl)-3-nitrobenzenesulfonamide |
| MolecularFormula | C19H13N5O6Cl2S |
| Smiles | [O-][N+](c(cc(cc1)S(Nc(cc2)ccc2Cl)(=O)=O)c1N/N=C\c(cc1)cc([N+]([O-])=O)c1Cl)=O |
| InChI | InChI=1S/C19H13Cl2N5O6S/c20-13-2-4-14(5-3-13)24-33(31,32)15-6-8-17(19(10-15)26(29)30)23-22-11-12-1-7-16(21)18(9-12)25(27)28/h1-11,23-24H |
| InChIK | UFBAUGYDCHRIFF-UHFFFAOYSA-N |
| TotalMolweight | 510.313 |
| Molweight | 510.313 |
| MonoisotopicMass | 508.996359 |
| CLogP | 4.5088 |
| CLogS | -6.874 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 347.22 |
| Relative PSA | 0.35669 |
| PolarSurfaceArea | 170.58 |
| Druglikeness | -3.1765 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.57576 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 3 |
| Symmetricatoms | 3 |
| Amides | 1 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(2Z)-2-[(4-chloro-3-nitrophenyl)methylidene]hydrazinyl]-N-(4-chlorophenyl)-3-nitrobenzenesulfonamide | 2 - 4-[(2Z)-2-[(4-chloro-3-nitrophenyl)methylidene]hydrazinyl]-N-(4-chlorophenyl)-3-nitrobenzenesulfonamide