| MolName | N,N'-bis[(Z)-(5-chlorothiophen-2-yl)methylideneamino]heptanediamide |
| MolecularFormula | C17H18N4O2Cl2S2 |
| Smiles | O=C(CCCCCC(N/N=C\c(s1)ccc1Cl)=O)N/N=C\c(s1)ccc1Cl |
| InChI | InChI=1S/C17H18Cl2N4O2S2/c18-14-8-6-12(26-14)10-20-22-16(24)4-2-1-3-5-17(25)23-21-11-13-7-9-15(19)27-13/h6-11H,1-5H2,(H,22,24)(H,23,25) |
| InChIK | UFGOHRUNYFKXSS-UHFFFAOYSA-N |
| TotalMolweight | 445.394 |
| Molweight | 445.394 |
| MonoisotopicMass | 444.02482 |
| CLogP | 6.165 |
| CLogS | -6.994 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 332.48 |
| Relative PSA | 0.33909 |
| PolarSurfaceArea | 139.4 |
| Druglikeness | -2.8267 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.77778 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 10 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| Sp3Atoms | 5 |
| Symmetricatoms | 13 |
| StereoCon |
Click to Load Molecule:
1 - N,N'-bis[(Z)-(5-chlorothiophen-2-yl)methylideneamino]heptanediamide | 2 - N,N'-bis[(Z)-(5-chlorothiophen-2-yl)methylideneamino]heptanediamide