| MolName | 3-[(4-chlorophenyl)sulfamoyl]-N-[(Z)-(2-fluorophenyl)methylideneamino]benzamide |
| MolecularFormula | C20H15N3O3ClFS |
| Smiles | O=C(c1cccc(S(Nc(cc2)ccc2Cl)(=O)=O)c1)N/N=C\c(cccc1)c1F |
| InChI | InChI=1S/C20H15ClFN3O3S/c21-16-8-10-17(11-9-16)25-29(27,28)18-6-3-5-14(12-18)20(26)24-23-13-15-4-1-2-7-19(15)22/h1-13,25H,(H,24,26) |
| InChIK | UFIGWYMYMCDCPU-UHFFFAOYSA-N |
| TotalMolweight | 431.874 |
| Molweight | 431.874 |
| MonoisotopicMass | 431.050667 |
| CLogP | 4.2075 |
| CLogS | -6.104 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 308.56 |
| Relative PSA | 0.24647 |
| PolarSurfaceArea | 96.01 |
| Druglikeness | 0.26889 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.62069 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 1 |
| Symmetricatoms | 3 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(4-chlorophenyl)sulfamoyl]-N-[(Z)-(2-fluorophenyl)methylideneamino]benzamide | 2 - 3-[(4-chlorophenyl)sulfamoyl]-N-[(Z)-(2-fluorophenyl)methylideneamino]benzamide