| MolName | N-[4-[[(Z)-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]carbamoyl]phenyl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| MolecularFormula | C28H22N3O3F3S |
| Smiles | O=C(c1csc2c1CCCC2)Nc(cc1)ccc1C(N/N=C\c1ccc(-c2cc(C(F)(F)F)ccc2)o1)=O |
| InChI | InChI=1S/C28H22F3N3O3S/c29-28(30,31)19-5-3-4-18(14-19)24-13-12-21(37-24)15-32-34-26(35)17-8-10-20(11-9-17)33-27(36)23-16-38-25-7-2-1-6-22(23)25/h3-5,8-16H,1-2,6-7H2,(H,33,36)(H,34,35) |
| InChIK | UFPOOMGDBSJJJX-UHFFFAOYSA-N |
| TotalMolweight | 537.561 |
| Molweight | 537.561 |
| MonoisotopicMass | 537.133396 |
| CLogP | 7.1597 |
| CLogS | -8.573 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 392.35 |
| Relative PSA | 0.24208 |
| PolarSurfaceArea | 111.94 |
| Druglikeness | -3.4618 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.60526 |
| Fragments | 1 |
| Non HAtoms | 38 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 5 |
| Symmetricatoms | 4 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[4-[[(Z)-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]carbamoyl]phenyl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide | 2 - N-[4-[[(Z)-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylideneamino]carbamoyl]phenyl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide